C12H24O2 — CID 123911610
2-(4,4-diethylcyclohexyl)ethane-1,1-diol (PubChem CID 123911610) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-(4,4-diethylcyclohexyl)ethane-1,1-diol.
| Compound Name | 2-(4,4-diethylcyclohexyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 123911610 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 2-(4,4-diethylcyclohexyl)ethane-1,1-diol |
| SMILES | CCC1(CC)CCC(CC(O)O)CC1 |
| InChI | InChI=1S/C12H24O2/c1-3-12(4-2)7-5-10(6-8-12)9-11(13)14/h10-11,13-14H,3-9H2,1-2H3 |
| InChIKey | NPILIBLJJWQUSG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|