C11H22S — CID 88538499
1-(3,3-diethylcyclopentyl)ethanethiol (PubChem CID 88538499) has the molecular formula C11H22S and a molecular weight of 186.36 g/mol. Its IUPAC name is 1-(3,3-diethylcyclopentyl)ethanethiol.
| Compound Name | 1-(3,3-diethylcyclopentyl)ethanethiol |
|---|---|
| PubChem CID | 88538499 |
| Molecular Formula | C11H22S |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-(3,3-diethylcyclopentyl)ethanethiol |
| SMILES | CCC1(CC)CCC(C(C)S)C1 |
| InChI | InChI=1S/C11H22S/c1-4-11(5-2)7-6-10(8-11)9(3)12/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | UKNVUYNFCZRERR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|