C12H18BrNO2 — CID 135389703
ethyl 3-(2-bromo-1H-pyridin-2-yl)-2,2-dimethylpropanoate (PubChem CID 135389703) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is ethyl 3-(2-bromo-1H-pyridin-2-yl)-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-(2-bromo-1H-pyridin-2-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135389703 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | ethyl 3-(2-bromo-1H-pyridin-2-yl)-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)CC1(Br)C=CC=CN1 |
| InChI | InChI=1S/C12H18BrNO2/c1-4-16-10(15)11(2,3)9-12(13)7-5-6-8-14-12/h5-8,14H,4,9H2,1-3H3 |
| InChIKey | SLDXGFFWFHQDRB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|