C17H12N4O3 — CID 135394527
benzyl N-(4-cyano-2-pyridin-3-yl-1,3-oxazol-5-yl)carbamate (PubChem CID 135394527) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is benzyl N-(4-cyano-2-pyridin-3-yl-1,3-oxazol-5-yl)carbamate.
| Compound Name | benzyl N-(4-cyano-2-pyridin-3-yl-1,3-oxazol-5-yl)carbamate |
|---|---|
| PubChem CID | 135394527 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | benzyl N-(4-cyano-2-pyridin-3-yl-1,3-oxazol-5-yl)carbamate |
| SMILES | N#Cc1nc(-c2cccnc2)oc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H12N4O3/c18-9-14-16(24-15(20-14)13-7-4-8-19-10-13)21-17(22)23-11-12-5-2-1-3-6-12/h1-8,10H,11H2,(H,21,22) |
| InChIKey | LNVLAUGFTMAXRB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |