C13H8F3N3O3 — CID 137347580
benzyl N-[4-cyano-2-(trifluoromethyl)-1,3-oxazol-5-yl]carbamate (PubChem CID 137347580) has the molecular formula C13H8F3N3O3 and a molecular weight of 311.22 g/mol. Its IUPAC name is benzyl N-[4-cyano-2-(trifluoromethyl)-1,3-oxazol-5-yl]carbamate.
| Compound Name | benzyl N-[4-cyano-2-(trifluoromethyl)-1,3-oxazol-5-yl]carbamate |
|---|---|
| PubChem CID | 137347580 |
| Molecular Formula | C13H8F3N3O3 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | benzyl N-[4-cyano-2-(trifluoromethyl)-1,3-oxazol-5-yl]carbamate |
| SMILES | N#Cc1nc(C(F)(F)F)oc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H8F3N3O3/c14-13(15,16)11-18-9(6-17)10(22-11)19-12(20)21-7-8-4-2-1-3-5-8/h1-5H,7H2,(H,19,20) |
| InChIKey | NMRBFNPZNQNYKT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |