C18H13F3N2O3 — CID 156694299
benzyl N-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]carbamate (PubChem CID 156694299) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is benzyl N-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]carbamate.
| Compound Name | benzyl N-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]carbamate |
|---|---|
| PubChem CID | 156694299 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | benzyl N-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]carbamate |
| SMILES | O=C(Nc1nc(-c2ccc(C(F)(F)F)cc2)co1)OCc1ccccc1 |
| InChI | InChI=1S/C18H13F3N2O3/c19-18(20,21)14-8-6-13(7-9-14)15-11-25-16(22-15)23-17(24)26-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,22,23,24) |
| InChIKey | LLAYKIWPKMWASK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |