C15H15F3N4O — CID 155585306
(1E,3Z)-1-N'-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]penta-1,3-diene-1,1,4-triamine (PubChem CID 155585306) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is (1E,3Z)-1-N'-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]penta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]penta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 155585306 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (1E,3Z)-1-N'-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]penta-1,3-diene-1,1,4-triamine |
| SMILES | C/C(N)=C/C=C(\N)Nc1nc(-c2ccc(C(F)(F)F)cc2)co1 |
| InChI | InChI=1S/C15H15F3N4O/c1-9(19)2-7-13(20)22-14-21-12(8-23-14)10-3-5-11(6-4-10)15(16,17)18/h2-8H,19-20H2,1H3,(H,21,22)/b9-2-,13-7+ |
| InChIKey | SWXDWYVKHLFOIY-LEFZJWHXSA-N |
| XLogP | 3.43 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|