C15H20F3N3 — CID 145074856
(1E,3Z)-5-methyl-1-N'-[[4-(trifluoromethyl)phenyl]methyl]hexa-1,3-diene-1,1,4-triamine (PubChem CID 145074856) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is (1E,3Z)-5-methyl-1-N'-[[4-(trifluoromethyl)phenyl]methyl]hexa-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-5-methyl-1-N'-[[4-(trifluoromethyl)phenyl]methyl]hexa-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 145074856 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (1E,3Z)-5-methyl-1-N'-[[4-(trifluoromethyl)phenyl]methyl]hexa-1,3-diene-1,1,4-triamine |
| SMILES | CC(C)/C(N)=C/C=C(\N)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3N3/c1-10(2)13(19)7-8-14(20)21-9-11-3-5-12(6-4-11)15(16,17)18/h3-8,10,21H,9,19-20H2,1-2H3/b13-7-,14-8+ |
| InChIKey | MVALCOLOWOQFEB-MFUUIURDSA-N |
| XLogP | 3.09 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|