C13H12F3NO4S — CID 86718618
[(1S)-1-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] methanesulfonate (PubChem CID 86718618) has the molecular formula C13H12F3NO4S and a molecular weight of 335.30 g/mol. Its IUPAC name is [(1S)-1-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] methanesulfonate.
| Compound Name | [(1S)-1-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 86718618 |
| Molecular Formula | C13H12F3NO4S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | [(1S)-1-[4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)c1nc(-c2ccc(C(F)(F)F)cc2)co1 |
| InChI | InChI=1S/C13H12F3NO4S/c1-8(21-22(2,18)19)12-17-11(7-20-12)9-3-5-10(6-4-9)13(14,15)16/h3-8H,1-2H3/t8-/m0/s1 |
| InChIKey | LHURVUZXDAMZTG-QMMMGPOBSA-N |
| XLogP | 3.40 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|