C12H10F3NO4S — CID 22064284
[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl methanesulfonate (PubChem CID 22064284) has the molecular formula C12H10F3NO4S and a molecular weight of 321.28 g/mol. Its IUPAC name is [2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl methanesulfonate.
| Compound Name | [2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 22064284 |
| Molecular Formula | C12H10F3NO4S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | [2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1coc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C12H10F3NO4S/c1-21(17,18)20-7-10-6-19-11(16-10)8-2-4-9(5-3-8)12(13,14)15/h2-6H,7H2,1H3 |
| InChIKey | BNMGMZKOGVIDIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|