C19H14F3NO3 — CID 54273330
3-methyl-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde (PubChem CID 54273330) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 3-methyl-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde.
| Compound Name | 3-methyl-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 54273330 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-methyl-5-[[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde |
| SMILES | Cc1cc(C=O)cc(OCc2coc(-c3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C19H14F3NO3/c1-12-6-13(9-24)8-17(7-12)25-10-16-11-26-18(23-16)14-2-4-15(5-3-14)19(20,21)22/h2-9,11H,10H2,1H3 |
| InChIKey | RLRXHMAHPUXFMP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|