C18H13F3NO5S- — CID 69110834
[4-[[2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl] sulfite (PubChem CID 69110834) has the molecular formula C18H13F3NO5S- and a molecular weight of 412.37 g/mol. Its IUPAC name is [4-[[2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl] sulfite.
| Compound Name | [4-[[2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl] sulfite |
|---|---|
| PubChem CID | 69110834 |
| Molecular Formula | C18H13F3NO5S- |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [4-[[2-[4-methyl-3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl] sulfite |
| SMILES | Cc1ccc(-c2nc(COc3ccc(OS(=O)[O-])cc3)co2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H14F3NO5S/c1-11-2-3-12(8-16(11)18(19,20)21)17-22-13(10-26-17)9-25-14-4-6-15(7-5-14)27-28(23)24/h2-8,10H,9H2,1H3,(H,23,24)/p-1 |
| InChIKey | DQXKPPDHXUQAHI-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|