C13H12NO6S- — CID 163906316
[4-[4-(2-ethoxy-2-oxoethyl)-1,3-oxazol-2-yl]phenyl] sulfite (PubChem CID 163906316) has the molecular formula C13H12NO6S- and a molecular weight of 310.31 g/mol. Its IUPAC name is [4-[4-(2-ethoxy-2-oxoethyl)-1,3-oxazol-2-yl]phenyl] sulfite.
| Compound Name | [4-[4-(2-ethoxy-2-oxoethyl)-1,3-oxazol-2-yl]phenyl] sulfite |
|---|---|
| PubChem CID | 163906316 |
| Molecular Formula | C13H12NO6S- |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | [4-[4-(2-ethoxy-2-oxoethyl)-1,3-oxazol-2-yl]phenyl] sulfite |
| SMILES | CCOC(=O)Cc1coc(-c2ccc(OS(=O)[O-])cc2)n1 |
| InChI | InChI=1S/C13H13NO6S/c1-2-18-12(15)7-10-8-19-13(14-10)9-3-5-11(6-4-9)20-21(16)17/h3-6,8H,2,7H2,1H3,(H,16,17)/p-1 |
| InChIKey | LMVRRNOIESSKMS-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|