C18H23NO3 — CID 160527947
ethyl 3,3-dimethyl-5-(2-phenyl-1,3-oxazol-4-yl)pentanoate (PubChem CID 160527947) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-5-(2-phenyl-1,3-oxazol-4-yl)pentanoate.
| Compound Name | ethyl 3,3-dimethyl-5-(2-phenyl-1,3-oxazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 160527947 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | ethyl 3,3-dimethyl-5-(2-phenyl-1,3-oxazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CC(C)(C)CCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H23NO3/c1-4-21-16(20)12-18(2,3)11-10-15-13-22-17(19-15)14-8-6-5-7-9-14/h5-9,13H,4,10-12H2,1-3H3 |
| InChIKey | QVDRXZUNDLQMIU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |