C15H15NO3 — CID 58334161
ethyl 2-[2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate (PubChem CID 58334161) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 2-[2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 58334161 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | ethyl 2-[2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1coc(/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C15H15NO3/c1-2-18-15(17)10-13-11-19-14(16-13)9-8-12-6-4-3-5-7-12/h3-9,11H,2,10H2,1H3/b9-8+ |
| InChIKey | WOXKKHQYBMGPKJ-CMDGGOBGSA-N |
| XLogP | 2.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |