C12H10N2O2 — CID 11117394
2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxamide (PubChem CID 11117394) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11117394 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C12H10N2O2/c13-12(15)10-8-16-11(14-10)7-6-9-4-2-1-3-5-9/h1-8H,(H2,13,15)/b7-6+ |
| InChIKey | XQGLCVZBMABLHU-VOTSOKGWSA-N |
| XLogP | 1.94 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |