C18H12F3NO3 — CID 130314528
(5E,6E)-5,6-di(ethylidene)-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazole-4,7-dione (PubChem CID 130314528) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is (5E,6E)-5,6-di(ethylidene)-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazole-4,7-dione.
| Compound Name | (5E,6E)-5,6-di(ethylidene)-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 130314528 |
| Molecular Formula | C18H12F3NO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (5E,6E)-5,6-di(ethylidene)-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazole-4,7-dione |
| SMILES | C/C=C1/C(=O)c2nc(-c3ccc(C(F)(F)F)cc3)oc2C(=O)/C1=C/C |
| InChI | InChI=1S/C18H12F3NO3/c1-3-11-12(4-2)15(24)16-13(14(11)23)22-17(25-16)9-5-7-10(8-6-9)18(19,20)21/h3-8H,1-2H3/b11-3+,12-4+ |
| InChIKey | CSEXJFNNTZTIMZ-HMMKTVFPSA-N |
| XLogP | 4.63 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|