C11H8F3NO2 — CID 59726235
2-methyl-4-[4-(trifluoromethoxy)phenyl]-1,3-oxazole (PubChem CID 59726235) has the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 2-methyl-4-[4-(trifluoromethoxy)phenyl]-1,3-oxazole.
| Compound Name | 2-methyl-4-[4-(trifluoromethoxy)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 59726235 |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-methyl-4-[4-(trifluoromethoxy)phenyl]-1,3-oxazole |
| SMILES | Cc1nc(-c2ccc(OC(F)(F)F)cc2)co1 |
| InChI | InChI=1S/C11H8F3NO2/c1-7-15-10(6-16-7)8-2-4-9(5-3-8)17-11(12,13)14/h2-6H,1H3 |
| InChIKey | NRSIKJOMZYLZQG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |