C16H13F3N2O4 — CID 164543105
methyl 5-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 164543105) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is methyl 5-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 164543105 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | methyl 5-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)OCc2ccccc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H13F3N2O4/c1-24-14(22)12-8-7-11(13(20-12)16(17,18)19)21-15(23)25-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,21,23) |
| InChIKey | BJXZXZZZKMERHV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |