About benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate
benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate (PubChem CID 56930138) has the molecular formula C13H10F3NO3
and a molecular weight of 285.22 g/mol. Its IUPAC name is benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate.
Analyze benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate?
The IUPAC name of benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate (CID 56930138) is benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate.
What is the SMILES notation for benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate?
The canonical SMILES for benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate is Cc1nc(C(F)(F)F)oc1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate?
The InChIKey is KJPOLAQGBBIMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO3/c1-8-10(20-12(17-8)13(14,15)16)11(18)19-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What are the key properties of benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate?
benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate has a molecular weight of 285.22 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-methyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 56930138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).