C16H19NO3 — CID 170382634
benzyl 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-methylpropanoate (PubChem CID 170382634) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is benzyl 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-methylpropanoate.
| Compound Name | benzyl 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 170382634 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | benzyl 2-(4,5-dimethyl-1,3-oxazol-2-yl)-2-methylpropanoate |
| SMILES | Cc1nc(C(C)(C)C(=O)OCc2ccccc2)oc1C |
| InChI | InChI=1S/C16H19NO3/c1-11-12(2)20-14(17-11)16(3,4)15(18)19-10-13-8-6-5-7-9-13/h5-9H,10H2,1-4H3 |
| InChIKey | VPINSXNJWGFYJZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |