About benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate
benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate (PubChem CID 166786253) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate.
Analyze benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate?
The IUPAC name of benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate (CID 166786253) is benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate.
What is the SMILES notation for benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate?
The canonical SMILES for benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate is Cc1nnc(C(C)(C)C(=O)OCc2ccccc2)n1C.
What is the InChIKey of benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate?
The InChIKey is FMTRXIAPWPIQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-11-16-17-13(18(11)4)15(2,3)14(19)20-10-12-8-6-5-7-9-12/h5-9H,10H2,1-4H3.
What are the key properties of benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate?
benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate has a molecular weight of 273.34 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(4,5-dimethyl-1,2,4-triazol-3-yl)-2-methylpropanoate is sourced from PubChem (CID 166786253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).