C36H24N4 — CID 135398456
(Z)-2-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-3-phenylprop-2-enenitrile (PubChem CID 135398456) has the molecular formula C36H24N4 and a molecular weight of 512.62 g/mol. Its IUPAC name is (Z)-2-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-3-phenylprop-2-enenitrile.
| Compound Name | (Z)-2-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 135398456 |
| Molecular Formula | C36H24N4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (Z)-2-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-3-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1)c1ccc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1 |
| InChI | InChI=1S/C36H24N4/c37-25-32(22-26-8-2-1-3-9-26)30-18-14-28(15-19-30)27-12-16-29(17-13-27)31-23-35(33-10-4-6-20-38-33)40-36(24-31)34-11-5-7-21-39-34/h1-24H/b32-22+ |
| InChIKey | WMLBMNWAYUFICU-WEMUVCOSSA-N |
| XLogP | 8.60 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|