C25H17ClN4O — CID 135399034
3-[4-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidin-2-yl]imino-1H-indol-2-one (PubChem CID 135399034) has the molecular formula C25H17ClN4O and a molecular weight of 424.89 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidin-2-yl]imino-1H-indol-2-one.
| Compound Name | 3-[4-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidin-2-yl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135399034 |
| Molecular Formula | C25H17ClN4O |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidin-2-yl]imino-1H-indol-2-one |
| SMILES | Cc1ccc(-c2cc(-c3ccc(Cl)cc3)nc(N=C3C(=O)Nc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C25H17ClN4O/c1-15-6-8-16(9-7-15)21-14-22(17-10-12-18(26)13-11-17)29-25(28-21)30-23-19-4-2-3-5-20(19)27-24(23)31/h2-14H,1H3,(H,27,28,29,30,31) |
| InChIKey | SKONOXXPWHDJBQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|