C14H14N2O2 — CID 135400195
2-(2-methylbut-3-yn-2-ylimino)-5-phenyl-1,3-oxazolidin-4-one (PubChem CID 135400195) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(2-methylbut-3-yn-2-ylimino)-5-phenyl-1,3-oxazolidin-4-one.
| Compound Name | 2-(2-methylbut-3-yn-2-ylimino)-5-phenyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 135400195 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2-methylbut-3-yn-2-ylimino)-5-phenyl-1,3-oxazolidin-4-one |
| SMILES | C#CC(C)(C)/N=C1/NC(=O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C14H14N2O2/c1-4-14(2,3)16-13-15-12(17)11(18-13)10-8-6-5-7-9-10/h1,5-9,11H,2-3H3,(H,15,16,17) |
| InChIKey | YRCKMRPUIXMLIR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|