C15H18N2O2 — CID 135401655
3-hydroxy-5,5-dimethyl-2-[(5-methyl-2-pyridinyl)iminomethyl]cyclohex-2-en-1-one (PubChem CID 135401655) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[(5-methyl-2-pyridinyl)iminomethyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[(5-methyl-2-pyridinyl)iminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135401655 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[(5-methyl-2-pyridinyl)iminomethyl]cyclohex-2-en-1-one |
| SMILES | Cc1ccc(/N=C/C2=C(O)CC(C)(C)CC2=O)nc1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-4-5-14(16-8-10)17-9-11-12(18)6-15(2,3)7-13(11)19/h4-5,8-9,18H,6-7H2,1-3H3/b17-9+ |
| InChIKey | BFCPIVHSGNKQTR-RQZCQDPDSA-N |
| XLogP | 3.29 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|