C14H15N3O4 — CID 135402405
3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)diazenyl]cyclohex-2-en-1-one (PubChem CID 135402405) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)diazenyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)diazenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135402405 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)diazenyl]cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(/N=N/c2cccc([N+](=O)[O-])c2)=C(O)C1 |
| InChI | InChI=1S/C14H15N3O4/c1-14(2)7-11(18)13(12(19)8-14)16-15-9-4-3-5-10(6-9)17(20)21/h3-6,18H,7-8H2,1-2H3/b16-15+ |
| InChIKey | LQCIRQQPOJWRLI-FOCLMDBBSA-N |
| XLogP | 3.84 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|