C23H26N2OS — CID 135402748
2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylpropyl)-1H-pyrimidin-6-one (PubChem CID 135402748) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylpropyl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylpropyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135402748 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-cyclohexylsulfanyl-4-(1-naphthalen-1-ylpropyl)-1H-pyrimidin-6-one |
| SMILES | CCC(c1cc(=O)[nH]c(SC2CCCCC2)n1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N2OS/c1-2-18(20-14-8-10-16-9-6-7-13-19(16)20)21-15-22(26)25-23(24-21)27-17-11-4-3-5-12-17/h6-10,13-15,17-18H,2-5,11-12H2,1H3,(H,24,25,26) |
| InChIKey | SUTXCEIOZRQIKX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |