C16H18Cl2N2OS — CID 135402783
2-butylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one (PubChem CID 135402783) has the molecular formula C16H18Cl2N2OS and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-butylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-butylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135402783 |
| Molecular Formula | C16H18Cl2N2OS |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-butylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-5-methyl-1H-pyrimidin-6-one |
| SMILES | CCCCSc1nc(Cc2c(Cl)cccc2Cl)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C16H18Cl2N2OS/c1-3-4-8-22-16-19-14(10(2)15(21)20-16)9-11-12(17)6-5-7-13(11)18/h5-7H,3-4,8-9H2,1-2H3,(H,19,20,21) |
| InChIKey | VYLWKZRBJKKHHL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|