C17H18Cl2N2OS — CID 135402776
2-cyclohexylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 135402776) has the molecular formula C17H18Cl2N2OS and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-cyclohexylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135402776 |
| Molecular Formula | C17H18Cl2N2OS |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-cyclohexylsulfanyl-4-[(2,6-dichlorophenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(Cc2c(Cl)cccc2Cl)nc(SC2CCCCC2)[nH]1 |
| InChI | InChI=1S/C17H18Cl2N2OS/c18-14-7-4-8-15(19)13(14)9-11-10-16(22)21-17(20-11)23-12-5-2-1-3-6-12/h4,7-8,10,12H,1-3,5-6,9H2,(H,20,21,22) |
| InChIKey | ANJWDLPRKFUSOO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |