C16H18ClFN2OS — CID 136504302
2-butylsulfanyl-4-[1-(2-chloro-6-fluorophenyl)ethyl]-1H-pyrimidin-6-one (PubChem CID 136504302) has the molecular formula C16H18ClFN2OS and a molecular weight of 340.85 g/mol. Its IUPAC name is 2-butylsulfanyl-4-[1-(2-chloro-6-fluorophenyl)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 2-butylsulfanyl-4-[1-(2-chloro-6-fluorophenyl)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136504302 |
| Molecular Formula | C16H18ClFN2OS |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-butylsulfanyl-4-[1-(2-chloro-6-fluorophenyl)ethyl]-1H-pyrimidin-6-one |
| SMILES | CCCCSc1nc(C(C)c2c(F)cccc2Cl)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H18ClFN2OS/c1-3-4-8-22-16-19-13(9-14(21)20-16)10(2)15-11(17)6-5-7-12(15)18/h5-7,9-10H,3-4,8H2,1-2H3,(H,19,20,21) |
| InChIKey | YCFZWRSEMHIJLW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|