C17H18ClFN2OS — CID 136504303
4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-1H-pyrimidin-6-one (PubChem CID 136504303) has the molecular formula C17H18ClFN2OS and a molecular weight of 352.86 g/mol. Its IUPAC name is 4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136504303 |
| Molecular Formula | C17H18ClFN2OS |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CC(c1cc(=O)[nH]c(SC2CCCC2)n1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H18ClFN2OS/c1-10(16-12(18)7-4-8-13(16)19)14-9-15(22)21-17(20-14)23-11-5-2-3-6-11/h4,7-11H,2-3,5-6H2,1H3,(H,20,21,22) |
| InChIKey | OVTHJDDPUVYTSJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |