C20H22N2OS — CID 135402799
2-butan-2-ylsulfanyl-5-methyl-4-(naphthalen-1-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 135402799) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-butan-2-ylsulfanyl-5-methyl-4-(naphthalen-1-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-butan-2-ylsulfanyl-5-methyl-4-(naphthalen-1-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135402799 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-butan-2-ylsulfanyl-5-methyl-4-(naphthalen-1-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | CCC(C)Sc1nc(Cc2cccc3ccccc23)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C20H22N2OS/c1-4-13(2)24-20-21-18(14(3)19(23)22-20)12-16-10-7-9-15-8-5-6-11-17(15)16/h5-11,13H,4,12H2,1-3H3,(H,21,22,23) |
| InChIKey | BTGBRPMNUAOQSO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |