C9H15N5O — CID 135406383
4-amino-2-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one (PubChem CID 135406383) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-amino-2-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135406383 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-amino-2-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N)c(N2CCNCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H15N5O/c1-6-12-8(10)7(9(15)13-6)14-4-2-11-3-5-14/h11H,2-5H2,1H3,(H3,10,12,13,15) |
| InChIKey | BMSARQMIZSIXLI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |