C27H32Cl2F4N8O2S — CID 135407959
N-[5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-3-pyridinyl]-1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazol-3-amine (PubChem CID 135407959) has the molecular formula C27H32Cl2F4N8O2S and a molecular weight of 679.57 g/mol. Its IUPAC name is N-[5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-3-pyridinyl]-1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazol-3-amine.
| Compound Name | N-[5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-3-pyridinyl]-1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 135407959 |
| Molecular Formula | C27H32Cl2F4N8O2S |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 678.17 |
| IUPAC Name | N-[5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-3-pyridinyl]-1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazol-3-amine |
| SMILES | CC[C@H]1CN(c2ncc(NC3=NS(=O)(=O)N/C3=N\CC(F)(F)F)cc2Cl)CCN1C1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C27H32Cl2F4N8O2S/c1-2-20-15-40(9-10-41(20)21-5-7-39(8-6-21)14-17-3-4-18(28)11-23(17)30)26-22(29)12-19(13-34-26)36-25-24(35-16-27(31,32)33)37-44(42,43)38-25/h3-4,11-13,20-21H,2,5-10,14-16H2,1H3,(H,35,37)(H,36,38)/t20-/m0/s1 |
| InChIKey | POMQFCZVKBJKOK-FQEVSTJZSA-N |
| XLogP | 4.71 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|