C17H19FN4O2S — CID 135408383
2-[(2Z)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 135408383) has the molecular formula C17H19FN4O2S and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[(2Z)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(2Z)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135408383 |
| Molecular Formula | C17H19FN4O2S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-[(2Z)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CC1S/C(=N\N=C2CCCCC2)NC1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN4O2S/c18-11-6-8-12(9-7-11)19-15(23)10-14-16(24)20-17(25-14)22-21-13-4-2-1-3-5-13/h6-9,14H,1-5,10H2,(H,19,23)(H,20,22,24) |
| InChIKey | CDKGJLWDJYWMRV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|