C19H21F3N4O2S — CID 135693223
2-[(2E)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 135693223) has the molecular formula C19H21F3N4O2S and a molecular weight of 426.46 g/mol. Its IUPAC name is 2-[(2E)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2E)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135693223 |
| Molecular Formula | C19H21F3N4O2S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[(2E)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CC1S/C(=N/N=C2CCCCCC2)NC1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H21F3N4O2S/c20-19(21,22)13-9-5-6-10-14(13)23-16(27)11-15-17(28)24-18(29-15)26-25-12-7-3-1-2-4-8-12/h5-6,9-10,15H,1-4,7-8,11H2,(H,23,27)(H,24,26,28) |
| InChIKey | QQERNXPHMYXBSR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|