C16H18F3N3O2S — CID 2867206
2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 2867206) has the molecular formula C16H18F3N3O2S and a molecular weight of 373.40 g/mol. Its IUPAC name is 2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2867206 |
| Molecular Formula | C16H18F3N3O2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC/N=C1/SC(CC(=O)Nc2cccc(C(F)(F)F)c2)C(=O)N1CC |
| InChI | InChI=1S/C16H18F3N3O2S/c1-3-20-15-22(4-2)14(24)12(25-15)9-13(23)21-11-7-5-6-10(8-11)16(17,18)19/h5-8,12H,3-4,9H2,1-2H3,(H,21,23)/b20-15+ |
| InChIKey | GBRVMTXTLBRRKE-HMMYKYKNSA-N |
| XLogP | 3.37 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|