C24H23F3N4O2 — CID 135408869
N-(2,6-dimethylphenyl)-4-oxo-2-[[2-(trifluoromethyl)phenyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide (PubChem CID 135408869) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-oxo-2-[[2-(trifluoromethyl)phenyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-oxo-2-[[2-(trifluoromethyl)phenyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135408869 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-oxo-2-[[2-(trifluoromethyl)phenyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)N1CCc2nc(Cc3ccccc3C(F)(F)F)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C24H23F3N4O2/c1-14-6-5-7-15(2)21(14)30-23(33)31-11-10-19-17(13-31)22(32)29-20(28-19)12-16-8-3-4-9-18(16)24(25,26)27/h3-9H,10-13H2,1-2H3,(H,30,33)(H,28,29,32) |
| InChIKey | YMTYVLDJXGGQCY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |