C24H26N4O2 — CID 135622631
N-(3,4-dimethylphenyl)-2-[(3-methylphenyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide (PubChem CID 135622631) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(3-methylphenyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(3-methylphenyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135622631 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(3-methylphenyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cccc(Cc2nc3c(c(=O)[nH]2)CN(C(=O)Nc2ccc(C)c(C)c2)CC3)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-15-5-4-6-18(11-15)13-22-26-21-9-10-28(14-20(21)23(29)27-22)24(30)25-19-8-7-16(2)17(3)12-19/h4-8,11-12H,9-10,13-14H2,1-3H3,(H,25,30)(H,26,27,29) |
| InChIKey | WGFVXQQZRXCVMD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |