C11H12N2O3S — CID 135409170
7-hydroxy-6-pentanoyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 135409170) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 7-hydroxy-6-pentanoyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-hydroxy-6-pentanoyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 135409170 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 7-hydroxy-6-pentanoyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCC(=O)c1c(O)nc2sccn2c1=O |
| InChI | InChI=1S/C11H12N2O3S/c1-2-3-4-7(14)8-9(15)12-11-13(10(8)16)5-6-17-11/h5-6,15H,2-4H2,1H3 |
| InChIKey | ULQVDWHTPZCPTJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |