C15H13N5O4 — CID 135409548
View drug profile → leteprinim4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid (PubChem CID 135409548) has the molecular formula C15H13N5O4 and a molecular weight of 327.30 g/mol. Its IUPAC name is 4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid.
| Compound Name | 4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 135409548 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-[3-(6-oxo-1H-purin-9-yl)propanoylamino]benzoic acid |
| SMILES | O=C(CCn1cnc2c(=O)[nH]cnc21)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H13N5O4/c21-11(19-10-3-1-9(2-4-10)15(23)24)5-6-20-8-18-12-13(20)16-7-17-14(12)22/h1-4,7-8H,5-6H2,(H,19,21)(H,23,24)(H,16,17,22) |
| InChIKey | JMPOIZCOJJMTHI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |