C17H17N5O3S — CID 3937364
4-[5-(6-sulfanylidene-3H-purin-9-yl)pentanoylamino]benzoic acid (PubChem CID 3937364) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[5-(6-sulfanylidene-3H-purin-9-yl)pentanoylamino]benzoic acid.
| Compound Name | 4-[5-(6-sulfanylidene-3H-purin-9-yl)pentanoylamino]benzoic acid |
|---|---|
| PubChem CID | 3937364 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-[5-(6-sulfanylidene-3H-purin-9-yl)pentanoylamino]benzoic acid |
| SMILES | O=C(CCCCn1cnc2c(=S)nc[nH]c21)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H17N5O3S/c23-13(21-12-6-4-11(5-7-12)17(24)25)3-1-2-8-22-10-20-14-15(22)18-9-19-16(14)26/h4-7,9-10H,1-3,8H2,(H,21,23)(H,24,25)(H,18,19,26) |
| InChIKey | QWUZXTDHPGGAAU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|