C17H12ClN5O3 — CID 135409554
[5-(2-chlorophenyl)-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-3-yl]methanol (PubChem CID 135409554) has the molecular formula C17H12ClN5O3 and a molecular weight of 369.77 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-3-yl]methanol.
| Compound Name | [5-(2-chlorophenyl)-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-3-yl]methanol |
|---|---|
| PubChem CID | 135409554 |
| Molecular Formula | C17H12ClN5O3 |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [5-(2-chlorophenyl)-7-nitro-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(c1ccccc1Cl)=Nc1c(n[nH]c1CO)N2 |
| InChI | InChI=1S/C17H12ClN5O3/c18-12-4-2-1-3-10(12)15-11-7-9(23(25)26)5-6-13(11)19-17-16(20-15)14(8-24)21-22-17/h1-7,24H,8H2,(H2,19,21,22) |
| InChIKey | GXLFFMIVIQILFQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|