C17H11N3O — CID 135409737
6-oxo-2,4-diphenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 135409737) has the molecular formula C17H11N3O and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-oxo-2,4-diphenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-2,4-diphenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135409737 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 6-oxo-2,4-diphenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C17H11N3O/c18-11-14-15(12-7-3-1-4-8-12)19-16(20-17(14)21)13-9-5-2-6-10-13/h1-10H,(H,19,20,21) |
| InChIKey | OJLBPYXICVIGMG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |