About 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one
2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one (PubChem CID 135410214) has the molecular formula C9H13N5O3
and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one |
| PubChem CID | 135410214 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CC[C@@H](O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N5O3/c10-9-12-7-6(8(17)13-9)11-4-14(7)2-1-5(16)3-15/h4-5,15-16H,1-3H2,(H3,10,12,13,17)/t5-/m1/s1 |
| InChIKey | QOVUZUCXPAZXDZ-RXMQYKEDSA-N |
| XLogP | -1.55 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one?
The IUPAC name of 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one (CID 135410214) is 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one?
The canonical SMILES for 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one is Nc1nc2c(ncn2CC[C@@H](O)CO)c(=O)[nH]1.
What is the InChIKey of 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one?
The InChIKey is QOVUZUCXPAZXDZ-RXMQYKEDSA-N. The full InChI is InChI=1S/C9H13N5O3/c10-9-12-7-6(8(17)13-9)11-4-14(7)2-1-5(16)3-15/h4-5,15-16H,1-3H2,(H3,10,12,13,17)/t5-/m1/s1.
What are the key properties of 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one?
2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one has a molecular weight of 239.23 g/mol, XLogP of -1.55, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-[(3R)-3,4-dihydroxybutyl]-1H-purin-6-one is sourced from PubChem (CID 135410214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).