C25H28N6O2 — CID 135410394
2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide (PubChem CID 135410394) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 135410394 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-(4-oxo-5H-pyridazino[4,5-b]indol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide |
| SMILES | O=C(Cn1ncc2c([nH]c3ccccc32)c1=O)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N6O2/c32-23(18-31-25(33)24-21(17-27-31)20-9-4-5-10-22(20)28-24)26-11-6-12-29-13-15-30(16-14-29)19-7-2-1-3-8-19/h1-5,7-10,17,28H,6,11-16,18H2,(H,26,32) |
| InChIKey | DPHFWGZOSYIUAY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|