C32H33N5O4 — CID 135410426
7-(2,3-dimethoxyphenyl)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide (PubChem CID 135410426) has the molecular formula C32H33N5O4 and a molecular weight of 551.65 g/mol. Its IUPAC name is 7-(2,3-dimethoxyphenyl)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide.
| Compound Name | 7-(2,3-dimethoxyphenyl)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 135410426 |
| Molecular Formula | C32H33N5O4 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 7-(2,3-dimethoxyphenyl)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
| SMILES | COc1cccc(C2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3c(C(=O)Nc4cccc(C)c4)cnn32)c1OC |
| InChI | InChI=1S/C32H33N5O4/c1-18-9-7-10-22(16-18)35-31(38)24-17-33-37-28(23-11-8-12-26(40-5)29(23)41-6)27(21(4)34-30(24)37)32(39)36-25-14-13-19(2)15-20(25)3/h7-17,28,34H,1-6H3,(H,35,38)(H,36,39) |
| InChIKey | KLKARUBANOFEJL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |