C30H28N6O4 — CID 136680095
(7S)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide (PubChem CID 136680095) has the molecular formula C30H28N6O4 and a molecular weight of 536.59 g/mol. Its IUPAC name is (7S)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide.
| Compound Name | (7S)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 136680095 |
| Molecular Formula | C30H28N6O4 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (7S)-6-N-(2,4-dimethylphenyl)-5-methyl-3-N-(3-methylphenyl)-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@H](c2ccccc2[N+](=O)[O-])n2ncc(C(=O)Nc3cccc(C)c3)c2N1 |
| InChI | InChI=1S/C30H28N6O4/c1-17-8-7-9-21(15-17)33-29(37)23-16-31-35-27(22-10-5-6-11-25(22)36(39)40)26(20(4)32-28(23)35)30(38)34-24-13-12-18(2)14-19(24)3/h5-16,27,32H,1-4H3,(H,33,37)(H,34,38)/t27-/m0/s1 |
| InChIKey | BECJXIYPJJFXJF-MHZLTWQESA-N |
| XLogP | 5.90 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|