C29H26N6O4 — CID 136813934
(7R)-6-N-(2,4-dimethylphenyl)-5-methyl-7-(2-nitrophenyl)-3-N-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide (PubChem CID 136813934) has the molecular formula C29H26N6O4 and a molecular weight of 522.57 g/mol. Its IUPAC name is (7R)-6-N-(2,4-dimethylphenyl)-5-methyl-7-(2-nitrophenyl)-3-N-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide.
| Compound Name | (7R)-6-N-(2,4-dimethylphenyl)-5-methyl-7-(2-nitrophenyl)-3-N-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 136813934 |
| Molecular Formula | C29H26N6O4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (7R)-6-N-(2,4-dimethylphenyl)-5-methyl-7-(2-nitrophenyl)-3-N-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@@H](c2ccccc2[N+](=O)[O-])n2ncc(C(=O)Nc3ccccc3)c2N1 |
| InChI | InChI=1S/C29H26N6O4/c1-17-13-14-23(18(2)15-17)33-29(37)25-19(3)31-27-22(28(36)32-20-9-5-4-6-10-20)16-30-34(27)26(25)21-11-7-8-12-24(21)35(38)39/h4-16,26,31H,1-3H3,(H,32,36)(H,33,37)/t26-/m1/s1 |
| InChIKey | GAWCXNUQTCQDRD-AREMUKBSSA-N |
| XLogP | 5.59 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|